![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| cover.jpg | 2021-01-19 11:38 | 42K | |
| 25 - Eleven.mp3 | 2021-01-19 11:38 | 2.9M | |
| 01 - Ki.mp3 | 2021-01-19 11:38 | 3.7M | |
| 22 - Mellohi.mp3 | 2021-01-19 11:38 | 4.0M | |
| 23 - Stal.mp3 | 2021-01-19 11:38 | 6.0M | |
| 05 - Flake.mp3 | 2021-01-19 11:38 | 6.7M | |
| 17 - Beginning 2.mp3 | 2021-01-19 11:38 | 6.9M | |
| 06 - Moog City 2.mp3 | 2021-01-19 11:38 | 7.1M | |
| 09 - Mutation.mp3 | 2021-01-19 11:38 | 7.3M | |
| 20 - Chirp.mp3 | 2021-01-19 11:38 | 7.4M | |
| 24 - Strad.mp3 | 2021-01-19 11:38 | 7.4M | |
| 29 - Far.mp3 | 2021-01-19 11:38 | 7.6M | |
| 27 - Mall.mp3 | 2021-01-19 11:38 | 7.8M | |
| 21 - Wait.mp3 | 2021-01-19 11:38 | 9.2M | |
| 11 - Warmth.mp3 | 2021-01-19 11:38 | 9.4M | |
| 12 - Floating Trees.mp3 | 2021-01-19 11:38 | 9.6M | |
| 14 - Kyoto.mp3 | 2021-01-19 11:38 | 9.7M | |
| 26 - Ward.mp3 | 2021-01-19 11:38 | 9.8M | |
| 07 - Concrete Halls.mp3 | 2021-01-19 11:38 | 9.9M | |
| 15 - Ballad of the Cats.mp3 | 2021-01-19 11:38 | 11M | |
| 30 - Intro.mp3 | 2021-01-19 11:38 | 11M | |
| 03 - Dead Voxel.mp3 | 2021-01-19 11:38 | 12M | |
| 13 - Aria Math.mp3 | 2021-01-19 11:38 | 12M | |
| 04 - Blind Spots.mp3 | 2021-01-19 11:38 | 13M | |
| 28 - Blocks.mp3 | 2021-01-19 11:38 | 13M | |
| 10 - Haunt Muskie.mp3 | 2021-01-19 11:38 | 14M | |
| 08 - Biome Fest.mp3 | 2021-01-19 11:38 | 15M | |
| 18 - Dreiton.mp3 | 2021-01-19 11:38 | 19M | |
| 16 - Taswell.mp3 | 2021-01-19 11:38 | 20M | |
| 02 - Alpha.mp3 | 2021-01-19 11:38 | 23M | |
| 19 - The End.mp3 | 2021-01-19 11:38 | 35M | |
